dcd22705 dcd22705
  • 10-02-2024
  • Biology
contestada

If the "x acid" had a pH of 1, what should the pH of the x/10 be?

Respuesta :

Otras preguntas

what is greater 5/8 or 9/14
Show that cos(A+45)=cos45(cosA-sinA)
A lottery ticket costs $5. You pick 3 two-digit numbers (anything from 00 to 99) in order. If you match the first number only, you win $200. If you match the f
The figure is made up of a semicircle and a rectangle. Irregular figure of semicircle and rectangle. The semicircle is on top of the rectangle with a solid bla
In triangle STU, u2 = s2 + t2. Which equation is true about the measure of the angles of the triangle? The measure of angle STU is equal to 100 degrees The
In a square, one pair of opposite sides was made 50% longer and the other pair of opposite sides was made 50% shorter What percent of the square’s area is the a
which statement below accurately reflects how the New Deal was implemented?
Why was Bohr’s atomic model replaced by the modern atomic model
A sunset appears red because A. scattering is prevented by small particles. B. it travels through less atmosphere. C. most of the blue and green has
A hydrate of CoCl2 has a mass of 17.40 g before heating. After heating, the mass of the anhydrous compound is found to be 10.27 g. Explain how you would deter