Seudónimo Seudónimo
  • 10-03-2021
  • Arts
contestada

Which of the following movements glorified war? (2 points)

a

Constructivism

b

Futurism

c

Precisionism

d

Purism

Respuesta :

xjvy xjvy
  • 10-03-2021

Answer:

The answer is B. Futurism

Answer Link

Otras preguntas

What is the albedo affect
I need help with this problem
What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2
Divide using the division algorithm. Write your answer in the form Q+RD where the degree of R is less than the degree of D. [tex]\frac{y^{2}+4y-14 }{y-2}[/tex]
He will contemplate each piece of art in the museum. What’s another word for contemplate? A challenge B ponder C condemn D replicate
does someone mind helping me with this problem? Thank you!
Solve (v + 2)² − 24 = 0 where v is a real number.
If you were to describe the layout of your school, what kind of order would you use? A.chronological order B.spatial order C.classic order D.climactic order E.r
three-part question that follows, provide your answer to each part in the given workspace. Identify each part with a coordinating response. Be s Use the figure
plss can someone answer this really need help correct answer only plsss dont answer this for just a points i can brainly the correct answer