Seudónimo Seudónimo

11-01-2017
Mathematics

contestada

Alejandro is making hamburgers in batches of 6. Hamburger buns are sold in packs of 8. What is the least number of hamburgers on a bun he can make with no leftovers

Respuesta :

Katelynn05 Katelynn05

11-01-2017

Your answer would be 24 :)

Answer Link

Otras preguntas

A fourth-grade class needs 5 leaves each day to feed its 2 caterpillars. How many leaves would the students need each day for 12 caterpillars?"

Why did Great Britain and France received the most financial aid in the Cold War.

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

URGENT! (Please give the correct answers!)Complete the table of input and output numbers for the function, y=4x-3.(Show your working).

introductions of debate

The main argument against the Bill of Rights was that O a) no one could understand them. Ob) they were too radical. Oc) they would result in civil unrest. d) th

At the end of a year, the gross debt of a country stood at about $23 trillion. Express this amount in dollars per person, assuming that the population of the co

show that 2x +1 is a factor of 2x3 +5x2+4x+1 and factories completely

Mardi knows that there are a lot of seniors in her community who cannot easily get out to run basic errands. She wants to create a project that would connect th

If a fair die is tossed 300 times, how many outcomes are expected to be 6?