28solisjessica 28solisjessica

13-01-2022
Mathematics

contestada

20/3 start fraction, 3, divided by, 20, end fraction of a number is what percentage of that number?

Respuesta :

sofiapotterslytherin sofiapotterslytherin

13-01-2022

Answer:

15%.

Step-by-step explanation:

Answer Link

Otras preguntas

an empty shipping box has a mass of 2.75kilogarams.an electronics store is packing 5 identical laptops in the shipping box.each laptop has mass of 1.65kg.the co

Describe segregation in United States

please answer URGENT area of shapes THANKS !!!!!!!!!!!

Alexa is teaching students to measure and compare the speed of a pencil as it is dropped from different heights Why is this experiment considered science? Are

Which type of poetry has no rules for formatting or structure

determine how many grams are in 5.50 atoms of mercury Hg

how many atoms are present in 200.g of glucose c^6 H^12 O^6

Can you write an account of the life of Michelangelo please?

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

Is the power to provide for the health and welfare of the American people delegated reserved or shared