tfaulk4329 tfaulk4329

11-10-2017
Chemistry

contestada

What is the difference between the equation for torque and the equation for work?

Respuesta :

jamalw3214 jamalw3214

13-10-2017

there is no difference i believe

Answer Link

Otras preguntas

The standard form of a linear equation is an equation in the form with not both and equal to ______.

who was the fast woman pailot

Aluminum reacts with chlorine gas to form aluminum chloride via the following reaction: 2Al(s) + 3Cl₂ (g)→2AlCl3 (s) You are given 31.0 g of aluminum and 36.0 g

Which equation shows the beta decay of a transuranium element?

write T if the statement is True and F if it is false and correct the false statement.1) mechanical wave is an electric perturbation.2)5×10^14Hz is a wave exist

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

whats standard form of 3.43x 10 to the fifth power

written one please answer

Describe the pattern in your own words:;1;8;27;64;125 and write down the next five terms

Three moles of an ideal gas are taken around the eyele acb shown in Fig.For this gas Co-29.2J/mol-K.Process ac is at constant pressure, process ba is at constan